C9H11FO3 — CID 71585922
3-fluoro-8-oxaspiro[4.5]decane-7,9-dione (PubChem CID 71585922) has the molecular formula C9H11FO3 and a molecular weight of 186.18 g/mol. Its IUPAC name is 3-fluoro-8-oxaspiro[4.5]decane-7,9-dione.
| Compound Name | 3-fluoro-8-oxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 71585922 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3-fluoro-8-oxaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCC(F)C2)CC(=O)O1 |
| InChI | InChI=1S/C9H11FO3/c10-6-1-2-9(3-6)4-7(11)13-8(12)5-9/h6H,1-5H2 |
| InChIKey | GMWAJWBZPNIUTB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|