C11H17NO2 — CID 119092959
3,8-dimethyl-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 119092959) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3,8-dimethyl-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 3,8-dimethyl-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 119092959 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3,8-dimethyl-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | CC1CCC2(CC(=O)N(C)C(=O)C2)C1 |
| InChI | InChI=1S/C11H17NO2/c1-8-3-4-11(5-8)6-9(13)12(2)10(14)7-11/h8H,3-7H2,1-2H3 |
| InChIKey | AFLDFSBLELBNNR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|