C15H26N2O2 — CID 125495895
(3R)-8-[3-(dimethylamino)propyl]-3-methyl-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 125495895) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is (3R)-8-[3-(dimethylamino)propyl]-3-methyl-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | (3R)-8-[3-(dimethylamino)propyl]-3-methyl-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 125495895 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (3R)-8-[3-(dimethylamino)propyl]-3-methyl-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | C[C@@H]1CCC2(CC(=O)N(CCCN(C)C)C(=O)C2)C1 |
| InChI | InChI=1S/C15H26N2O2/c1-12-5-6-15(9-12)10-13(18)17(14(19)11-15)8-4-7-16(2)3/h12H,4-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | RWCFGLBJOSCNEF-GFCCVEGCSA-N |
| XLogP | 1.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|