C25H30ClN3O2 — CID 71586425
propan-2-yl 5-amino-4-(2-chlorophenyl)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate (PubChem CID 71586425) has the molecular formula C25H30ClN3O2 and a molecular weight of 439.99 g/mol. Its IUPAC name is propan-2-yl 5-amino-4-(2-chlorophenyl)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate.
| Compound Name | propan-2-yl 5-amino-4-(2-chlorophenyl)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 71586425 |
| Molecular Formula | C25H30ClN3O2 |
| Molecular Weight | 439.99 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | propan-2-yl 5-amino-4-(2-chlorophenyl)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccccc2Cl)c2c(nc3c(c2N)CC(C)(C)CC3)N1 |
| InChI | InChI=1S/C25H30ClN3O2/c1-13(2)31-24(30)19-14(3)28-23-21(20(19)15-8-6-7-9-17(15)26)22(27)16-12-25(4,5)11-10-18(16)29-23/h6-9,13,20H,10-12H2,1-5H3,(H3,27,28,29) |
| InChIKey | NKSOLADTIRLMCA-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |