C32H41N3O2 — CID 137483428
cyclopropen-1-ylmethyl 4-(2-butan-2-ylphenyl)-5-(ethylamino)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate (PubChem CID 137483428) has the molecular formula C32H41N3O2 and a molecular weight of 499.70 g/mol. Its IUPAC name is cyclopropen-1-ylmethyl 4-(2-butan-2-ylphenyl)-5-(ethylamino)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate.
| Compound Name | cyclopropen-1-ylmethyl 4-(2-butan-2-ylphenyl)-5-(ethylamino)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 137483428 |
| Molecular Formula | C32H41N3O2 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | cyclopropen-1-ylmethyl 4-(2-butan-2-ylphenyl)-5-(ethylamino)-2,7,7-trimethyl-4,6,8,9-tetrahydro-1H-benzo[b][1,8]naphthyridine-3-carboxylate |
| SMILES | CCNc1c2c(nc3c1C(c1ccccc1C(C)CC)C(C(=O)OCC1=CC1)=C(C)N3)CCC(C)(C)C2 |
| InChI | InChI=1S/C32H41N3O2/c1-7-19(3)22-11-9-10-12-23(22)27-26(31(36)37-18-21-13-14-21)20(4)34-30-28(27)29(33-8-2)24-17-32(5,6)16-15-25(24)35-30/h9-13,19,27H,7-8,14-18H2,1-6H3,(H2,33,34,35) |
| InChIKey | IKNDSDVYAUBOQM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|