C28H48N4O11S4 — CID 71586731
(3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid;(2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 71586731) has the molecular formula C28H48N4O11S4 and a molecular weight of 744.98 g/mol. Its IUPAC name is (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid;(2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid;(2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71586731 |
| Molecular Formula | C28H48N4O11S4 |
| Molecular Weight | 744.98 g/mol |
| Exact Mass | 744.22 |
| IUPAC Name | (3S)-3-amino-4-[[(2S)-2-amino-4-sulfobutyl]disulfanyl]butane-1-sulfonic acid;(2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O.N[C@@H](CCS(=O)(=O)O)CSSC[C@@H](N)CCS(=O)(=O)O |
| InChI | InChI=1S/C20H28N2O5.C8H20N2O6S4/c1-3-27-20(26)16(12-11-15-8-5-4-6-9-15)21-14(2)18(23)22-13-7-10-17(22)19(24)25;9-7(1-3-19(11,12)13)5-17-18-6-8(10)2-4-20(14,15)16/h4-6,8-9,14,16-17,21H,3,7,10-13H2,1-2H3,(H,24,25);7-8H,1-6,9-10H2,(H,11,12,13)(H,14,15,16)/t14-,16-,17-;7-,8-/m00/s1 |
| InChIKey | LNVKQHOPZIHOFT-QANFQBQJSA-N |
| XLogP | 1.18 |
| TPSA | 256.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.98 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|