C23H33N3O6S — CID 70514373
ethyl 2-[[(2S)-1-oxo-1-[(2S)-2-(prop-2-enylsulfonylcarbamoyl)pyrrolidin-1-yl]propan-2-yl]amino]-4-phenylbutanoate (PubChem CID 70514373) has the molecular formula C23H33N3O6S and a molecular weight of 479.60 g/mol. Its IUPAC name is ethyl 2-[[(2S)-1-oxo-1-[(2S)-2-(prop-2-enylsulfonylcarbamoyl)pyrrolidin-1-yl]propan-2-yl]amino]-4-phenylbutanoate.
| Compound Name | ethyl 2-[[(2S)-1-oxo-1-[(2S)-2-(prop-2-enylsulfonylcarbamoyl)pyrrolidin-1-yl]propan-2-yl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 70514373 |
| Molecular Formula | C23H33N3O6S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | ethyl 2-[[(2S)-1-oxo-1-[(2S)-2-(prop-2-enylsulfonylcarbamoyl)pyrrolidin-1-yl]propan-2-yl]amino]-4-phenylbutanoate |
| SMILES | C=CCS(=O)(=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(CCc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C23H33N3O6S/c1-4-16-33(30,31)25-21(27)20-12-9-15-26(20)22(28)17(3)24-19(23(29)32-5-2)14-13-18-10-7-6-8-11-18/h4,6-8,10-11,17,19-20,24H,1,5,9,12-16H2,2-3H3,(H,25,27)/t17-,19?,20-/m0/s1 |
| InChIKey | KGZZOSZEHSAFSI-SPFPWHRZSA-N |
| XLogP | 1.15 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|