About potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate
potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate (PubChem CID 71587263) has the molecular formula C19H34KNO5
and a molecular weight of 395.58 g/mol. Its IUPAC name is potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate.
Molecular Properties
| Compound Name | potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate |
| PubChem CID | 71587263 |
| Molecular Formula | C19H34KNO5 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate |
| SMILES | CCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[H+].[K+] |
| InChI | InChI=1S/C19H35NO5.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);/q;+1/p-1/t16-;/m0./s1 |
| InChIKey | KYLDDUZJZSKJER-NTISSMGPSA-M |
| XLogP | -1.43 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate?
The IUPAC name of potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate (CID 71587263) is potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate.
What is the SMILES notation for potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate?
The canonical SMILES for potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate is CCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[H+].[K+].
What is the InChIKey of potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate?
The InChIKey is KYLDDUZJZSKJER-NTISSMGPSA-M. The full InChI is InChI=1S/C19H35NO5.K/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(21)20-16(19(24)25)14-15-18(22)23;/h16H,2-15H2,1H3,(H,20,21)(H,22,23)(H,24,25);/q;+1/p-1/t16-;/m0./s1.
What are the key properties of potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate?
potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate has a molecular weight of 395.58 g/mol, XLogP of -1.43, 17 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydron;(2S)-2-(tetradecanoylamino)pentanedioate is sourced from PubChem (CID 71587263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).