C32H32Cl2N10O4 — CID 71588224
7-chloro-N-[3-(2-methyl-4-nitroimidazol-1-yl)propyl]quinolin-4-amine;7-chloro-N-[3-(2-methyl-5-nitroimidazol-1-yl)propyl]quinolin-4-amine (PubChem CID 71588224) has the molecular formula C32H32Cl2N10O4 and a molecular weight of 691.58 g/mol. Its IUPAC name is 7-chloro-N-[3-(2-methyl-4-nitroimidazol-1-yl)propyl]quinolin-4-amine;7-chloro-N-[3-(2-methyl-5-nitroimidazol-1-yl)propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-(2-methyl-4-nitroimidazol-1-yl)propyl]quinolin-4-amine;7-chloro-N-[3-(2-methyl-5-nitroimidazol-1-yl)propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 71588224 |
| Molecular Formula | C32H32Cl2N10O4 |
| Molecular Weight | 691.58 g/mol |
| Exact Mass | 690.20 |
| IUPAC Name | 7-chloro-N-[3-(2-methyl-4-nitroimidazol-1-yl)propyl]quinolin-4-amine;7-chloro-N-[3-(2-methyl-5-nitroimidazol-1-yl)propyl]quinolin-4-amine |
| SMILES | Cc1nc([N+](=O)[O-])cn1CCCNc1ccnc2cc(Cl)ccc12.Cc1ncc([N+](=O)[O-])n1CCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/2C16H16ClN5O2/c1-11-20-16(22(23)24)10-21(11)8-2-6-18-14-5-7-19-15-9-12(17)3-4-13(14)15;1-11-20-10-16(22(23)24)21(11)8-2-6-18-14-5-7-19-15-9-12(17)3-4-13(14)15/h2*3-5,7,9-10H,2,6,8H2,1H3,(H,18,19) |
| InChIKey | VAHJBADQWJGICH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 171.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.58 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|