C32H43F3N4O7 — CID 71588587
[(2S)-8-[(6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-3-oxooctan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 71588587) has the molecular formula C32H43F3N4O7 and a molecular weight of 652.71 g/mol. Its IUPAC name is [(2S)-8-[(6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-3-oxooctan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S)-8-[(6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-3-oxooctan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71588587 |
| Molecular Formula | C32H43F3N4O7 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | [(2S)-8-[(6S,9S,12R,14S)-3-benzyl-6-ethyl-6,14-dimethyl-2,5,8,11-tetraoxo-1,4,7,10-tetrazabicyclo[10.3.0]pentadecan-9-yl]-3-oxooctan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@H](C)OC(=O)C(F)(F)F)NC(=O)[C@H]2C[C@H](C)CN2C(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C32H43F3N4O7/c1-5-31(4)29(44)37-23(17-21-12-8-6-9-13-21)28(43)39-18-19(2)16-24(39)27(42)36-22(26(41)38-31)14-10-7-11-15-25(40)20(3)46-30(45)32(33,34)35/h6,8-9,12-13,19-20,22-24H,5,7,10-11,14-18H2,1-4H3,(H,36,42)(H,37,44)(H,38,41)/t19-,20-,22-,23?,24+,31-/m0/s1 |
| InChIKey | MSZXQLWWOPOALQ-HUZXQFJGSA-N |
| XLogP | 2.75 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|