C17H20Cl2N5+ — CID 71588709
N-[(2,4-dichlorophenyl)methyl]-N-[2-(1H-imidazol-3-ium-3-yl)ethyl]-2-imidazol-1-ylethanamine (PubChem CID 71588709) has the molecular formula C17H20Cl2N5+ and a molecular weight of 365.29 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-N-[2-(1H-imidazol-3-ium-3-yl)ethyl]-2-imidazol-1-ylethanamine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-N-[2-(1H-imidazol-3-ium-3-yl)ethyl]-2-imidazol-1-ylethanamine |
|---|---|
| PubChem CID | 71588709 |
| Molecular Formula | C17H20Cl2N5+ |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-N-[2-(1H-imidazol-3-ium-3-yl)ethyl]-2-imidazol-1-ylethanamine |
| SMILES | Clc1ccc(CN(CCn2ccnc2)CC[n+]2cc[nH]c2)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2N5/c18-16-2-1-15(17(19)11-16)12-22(7-9-23-5-3-20-13-23)8-10-24-6-4-21-14-24/h1-6,11,13-14H,7-10,12H2/p+1 |
| InChIKey | GBIGIWYLVPYNEL-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 40.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|