C31H24N2O3 — CID 71592577
3-[[6-[1-(4-methoxyphenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 71592577) has the molecular formula C31H24N2O3 and a molecular weight of 472.54 g/mol. Its IUPAC name is 3-[[6-[1-(4-methoxyphenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[6-[1-(4-methoxyphenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 71592577 |
| Molecular Formula | C31H24N2O3 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-[[6-[1-(4-methoxyphenyl)indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(-n2ccc3ccc(-c4ccc5ccn(Cc6cccc(C(=O)O)c6)c5c4)cc32)cc1 |
| InChI | InChI=1S/C31H24N2O3/c1-36-28-11-9-27(10-12-28)33-16-14-23-6-8-25(19-30(23)33)24-7-5-22-13-15-32(29(22)18-24)20-21-3-2-4-26(17-21)31(34)35/h2-19H,20H2,1H3,(H,34,35) |
| InChIKey | JTFGNEKPLHNXIC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |