C21H16ClN5O2 — CID 71594189
10-amino-8-(4-chlorophenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3(7),5,9-tetraen-12-one (PubChem CID 71594189) has the molecular formula C21H16ClN5O2 and a molecular weight of 405.85 g/mol. Its IUPAC name is 10-amino-8-(4-chlorophenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3(7),5,9-tetraen-12-one.
| Compound Name | 10-amino-8-(4-chlorophenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3(7),5,9-tetraen-12-one |
|---|---|
| PubChem CID | 71594189 |
| Molecular Formula | C21H16ClN5O2 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 10-amino-8-(4-chlorophenyl)-6-methyl-4-phenyl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3(7),5,9-tetraen-12-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccc(Cl)cc1)c1c(nc(=O)[nH]c1N)O2 |
| InChI | InChI=1S/C21H16ClN5O2/c1-11-15-16(12-7-9-13(22)10-8-12)17-18(23)24-21(28)25-19(17)29-20(15)27(26-11)14-5-3-2-4-6-14/h2-10,16H,1H3,(H3,23,24,25,28) |
| InChIKey | KMTIATHXBWFJAL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |