C24H18F3N3O2S — CID 71594226
5-(4-methylsulfonylphenyl)-3-[6-[3-(trifluoromethyl)phenyl]-3-pyridinyl]pyridin-2-amine (PubChem CID 71594226) has the molecular formula C24H18F3N3O2S and a molecular weight of 469.49 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-3-[6-[3-(trifluoromethyl)phenyl]-3-pyridinyl]pyridin-2-amine.
| Compound Name | 5-(4-methylsulfonylphenyl)-3-[6-[3-(trifluoromethyl)phenyl]-3-pyridinyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71594226 |
| Molecular Formula | C24H18F3N3O2S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-3-[6-[3-(trifluoromethyl)phenyl]-3-pyridinyl]pyridin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(N)c(-c3ccc(-c4cccc(C(F)(F)F)c4)nc3)c2)cc1 |
| InChI | InChI=1S/C24H18F3N3O2S/c1-33(31,32)20-8-5-15(6-9-20)18-12-21(23(28)30-14-18)17-7-10-22(29-13-17)16-3-2-4-19(11-16)24(25,26)27/h2-14H,1H3,(H2,28,30) |
| InChIKey | BMVQTAHJOXPJAJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |