C23H18F3N5O — CID 71594333
4-[(1H-benzimidazol-2-ylamino)methyl]-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]benzamide (PubChem CID 71594333) has the molecular formula C23H18F3N5O and a molecular weight of 437.43 g/mol. Its IUPAC name is 4-[(1H-benzimidazol-2-ylamino)methyl]-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(1H-benzimidazol-2-ylamino)methyl]-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 71594333 |
| Molecular Formula | C23H18F3N5O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-[(1H-benzimidazol-2-ylamino)methyl]-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(C(F)(F)F)cc1)c1ccc(CNc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C23H18F3N5O/c24-23(25,26)18-11-7-16(8-12-18)14-28-31-21(32)17-9-5-15(6-10-17)13-27-22-29-19-3-1-2-4-20(19)30-22/h1-12,14H,13H2,(H,31,32)(H2,27,29,30)/b28-14+ |
| InChIKey | BNPDRGQQNXWHFI-CCVNUDIWSA-N |
| XLogP | 4.96 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|