C29H28ClN3O4 — CID 71594917
(2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(7-chloro-1-ethyl-2-methylindol-3-yl)acetyl]amino]-3-phenylpropanamide (PubChem CID 71594917) has the molecular formula C29H28ClN3O4 and a molecular weight of 518.01 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(7-chloro-1-ethyl-2-methylindol-3-yl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(7-chloro-1-ethyl-2-methylindol-3-yl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 71594917 |
| Molecular Formula | C29H28ClN3O4 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[2-(7-chloro-1-ethyl-2-methylindol-3-yl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCn1c(C)c(CC(=O)N[C@@H](Cc2ccccc2)C(=O)Nc2ccc3c(c2)OCO3)c2cccc(Cl)c21 |
| InChI | InChI=1S/C29H28ClN3O4/c1-3-33-18(2)22(21-10-7-11-23(30)28(21)33)16-27(34)32-24(14-19-8-5-4-6-9-19)29(35)31-20-12-13-25-26(15-20)37-17-36-25/h4-13,15,24H,3,14,16-17H2,1-2H3,(H,31,35)(H,32,34)/t24-/m0/s1 |
| InChIKey | LMQISRCPGKZKRS-DEOSSOPVSA-N |
| XLogP | 5.26 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|