C22H16N2O6 — CID 71595353
2-[[4-[(2-hydroxybenzoyl)carbamoyl]phenyl]carbamoyl]benzoic acid (PubChem CID 71595353) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is 2-[[4-[(2-hydroxybenzoyl)carbamoyl]phenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[(2-hydroxybenzoyl)carbamoyl]phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 71595353 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[[4-[(2-hydroxybenzoyl)carbamoyl]phenyl]carbamoyl]benzoic acid |
| SMILES | O=C(NC(=O)c1ccccc1O)c1ccc(NC(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H16N2O6/c25-18-8-4-3-7-17(18)21(28)24-19(26)13-9-11-14(12-10-13)23-20(27)15-5-1-2-6-16(15)22(29)30/h1-12,25H,(H,23,27)(H,29,30)(H,24,26,28) |
| InChIKey | JYXVRQALNPEGTP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|