C19H17FN2O4 — CID 71595844
2-[[1-[(4-fluorophenyl)methyl]-4-methoxyindole-3-carbonyl]amino]acetic acid (PubChem CID 71595844) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-[[1-[(4-fluorophenyl)methyl]-4-methoxyindole-3-carbonyl]amino]acetic acid.
| Compound Name | 2-[[1-[(4-fluorophenyl)methyl]-4-methoxyindole-3-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 71595844 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[[1-[(4-fluorophenyl)methyl]-4-methoxyindole-3-carbonyl]amino]acetic acid |
| SMILES | COc1cccc2c1c(C(=O)NCC(=O)O)cn2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN2O4/c1-26-16-4-2-3-15-18(16)14(19(25)21-9-17(23)24)11-22(15)10-12-5-7-13(20)8-6-12/h2-8,11H,9-10H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | BTBNGZUDIQTRHE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |