C12H14O2 — CID 71597749
(3Z)-3-butylidene-6,7-dihydro-2-benzofuran-1-one (PubChem CID 71597749) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3Z)-3-butylidene-6,7-dihydro-2-benzofuran-1-one.
| Compound Name | (3Z)-3-butylidene-6,7-dihydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 71597749 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (3Z)-3-butylidene-6,7-dihydro-2-benzofuran-1-one |
| SMILES | CCC/C=C1\OC(=O)C2=C1C=CCC2 |
| InChI | InChI=1S/C12H14O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h4,6,8H,2-3,5,7H2,1H3/b11-8- |
| InChIKey | IEEZMHIRSMMXSL-FLIBITNWSA-N |
| XLogP | 2.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |