C36H21Cl4N5O4 — CID 71597854
2-(2-chlorophenyl)-6-[2-[2-(2-chlorophenyl)-4-oxoquinazolin-3-yl]ethyl]-3-(2,6-dichloro-4-nitrophenyl)quinazolin-4-one (PubChem CID 71597854) has the molecular formula C36H21Cl4N5O4 and a molecular weight of 729.41 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-6-[2-[2-(2-chlorophenyl)-4-oxoquinazolin-3-yl]ethyl]-3-(2,6-dichloro-4-nitrophenyl)quinazolin-4-one.
| Compound Name | 2-(2-chlorophenyl)-6-[2-[2-(2-chlorophenyl)-4-oxoquinazolin-3-yl]ethyl]-3-(2,6-dichloro-4-nitrophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 71597854 |
| Molecular Formula | C36H21Cl4N5O4 |
| Molecular Weight | 729.41 g/mol |
| Exact Mass | 727.03 |
| IUPAC Name | 2-(2-chlorophenyl)-6-[2-[2-(2-chlorophenyl)-4-oxoquinazolin-3-yl]ethyl]-3-(2,6-dichloro-4-nitrophenyl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2Cl)n1CCc1ccc2nc(-c3ccccc3Cl)n(-c3c(Cl)cc([N+](=O)[O-])cc3Cl)c(=O)c2c1 |
| InChI | InChI=1S/C36H21Cl4N5O4/c37-26-10-4-1-7-22(26)33-41-30-12-6-3-9-24(30)35(46)43(33)16-15-20-13-14-31-25(17-20)36(47)44(34(42-31)23-8-2-5-11-27(23)38)32-28(39)18-21(45(48)49)19-29(32)40/h1-14,17-19H,15-16H2 |
| InChIKey | SZHQTPLLMBXIFO-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 112.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.41 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|