C30H37FO3 — CID 71598314
[(3S,10R,13S)-17-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 71598314) has the molecular formula C30H37FO3 and a molecular weight of 464.62 g/mol. Its IUPAC name is [(3S,10R,13S)-17-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,10R,13S)-17-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 71598314 |
| Molecular Formula | C30H37FO3 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [(3S,10R,13S)-17-[(E)-3-(4-fluorophenyl)prop-2-enoyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C4CCC(C(=O)/C=C/c5ccc(F)cc5)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C30H37FO3/c1-19(32)34-23-14-16-29(2)21(18-23)7-10-24-25-11-12-27(30(25,3)17-15-26(24)29)28(33)13-6-20-4-8-22(31)9-5-20/h4-9,13,23-27H,10-12,14-18H2,1-3H3/b13-6+/t23-,24?,25?,26?,27?,29-,30-/m0/s1 |
| InChIKey | KJSGSWUPYQAKMS-KDWUKKHASA-N |
| XLogP | 6.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|