C25H21F3N4O2S2 — CID 71598349
1-benzyl-3-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylthiourea (PubChem CID 71598349) has the molecular formula C25H21F3N4O2S2 and a molecular weight of 530.60 g/mol. Its IUPAC name is 1-benzyl-3-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylthiourea.
| Compound Name | 1-benzyl-3-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylthiourea |
|---|---|
| PubChem CID | 71598349 |
| Molecular Formula | C25H21F3N4O2S2 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | 1-benzyl-3-[4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]phenyl]sulfonylthiourea |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2-c2ccc(S(=O)(=O)NC(=S)NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H21F3N4O2S2/c1-17-7-9-19(10-8-17)22-15-23(25(26,27)28)30-32(22)20-11-13-21(14-12-20)36(33,34)31-24(35)29-16-18-5-3-2-4-6-18/h2-15H,16H2,1H3,(H2,29,31,35) |
| InChIKey | BEDZHLFGDMXGSI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|