C26H33N5O3S — CID 52951865
1-cycloheptyl-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea (PubChem CID 52951865) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-cycloheptyl-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea.
| Compound Name | 1-cycloheptyl-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea |
|---|---|
| PubChem CID | 52951865 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-cycloheptyl-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(CCCNC(=O)NC3CCCCCC3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H33N5O3S/c27-35(33,34)24-16-14-23(15-17-24)31-25(20-9-4-3-5-10-20)19-22(30-31)13-8-18-28-26(32)29-21-11-6-1-2-7-12-21/h3-5,9-10,14-17,19,21H,1-2,6-8,11-13,18H2,(H2,27,33,34)(H2,28,29,32) |
| InChIKey | YWSQVXZPIBFORJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|