C28H32N4O3S — CID 52951485
1-(1-adamantyl)-3-[[1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl]urea (PubChem CID 52951485) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl]urea |
|---|---|
| PubChem CID | 52951485 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-(1-adamantyl)-3-[[1-(4-methylsulfonylphenyl)-5-phenylpyrazol-3-yl]methyl]urea |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N4O3S/c1-36(34,35)25-9-7-24(8-10-25)32-26(22-5-3-2-4-6-22)14-23(31-32)18-29-27(33)30-28-15-19-11-20(16-28)13-21(12-19)17-28/h2-10,14,19-21H,11-13,15-18H2,1H3,(H2,29,30,33) |
| InChIKey | BEOYZUSHFBUFIB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |