C29H35N5O3S — CID 52951864
1-(1-adamantyl)-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea (PubChem CID 52951864) has the molecular formula C29H35N5O3S and a molecular weight of 533.70 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea |
|---|---|
| PubChem CID | 52951864 |
| Molecular Formula | C29H35N5O3S |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[5-phenyl-1-(4-sulfamoylphenyl)pyrazol-3-yl]propyl]urea |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(CCCNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H35N5O3S/c30-38(36,37)26-10-8-25(9-11-26)34-27(23-5-2-1-3-6-23)16-24(33-34)7-4-12-31-28(35)32-29-17-20-13-21(18-29)15-22(14-20)19-29/h1-3,5-6,8-11,16,20-22H,4,7,12-15,17-19H2,(H2,30,36,37)(H2,31,32,35) |
| InChIKey | SNQCXPUFKABVNR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|