C14H13NO5 — CID 71601073
1-(3-carboxy-4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 71601073) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 1-(3-carboxy-4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-(3-carboxy-4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 71601073 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(3-carboxy-4-hydroxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H13NO5/c1-7-5-10(13(17)18)8(2)15(7)9-3-4-12(16)11(6-9)14(19)20/h3-6,16H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | XMHLCCMYHAZFEK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|