C20H19N3 — CID 716012
N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-2-amine (PubChem CID 716012) has the molecular formula C20H19N3 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-2-amine.
| Compound Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-2-amine |
|---|---|
| PubChem CID | 716012 |
| Molecular Formula | C20H19N3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-2-amine |
| SMILES | C[C@H](Cc1c[nH]c2ccccc12)Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H19N3/c1-14(12-16-13-21-19-9-5-3-7-17(16)19)22-20-11-10-15-6-2-4-8-18(15)23-20/h2-11,13-14,21H,12H2,1H3,(H,22,23)/t14-/m1/s1 |
| InChIKey | JROTXPVKVRQMGU-CQSZACIVSA-N |
| XLogP | 4.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |