C20H20N3+ — CID 6926350
N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-1-ium-2-amine (PubChem CID 6926350) has the molecular formula C20H20N3+ and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-1-ium-2-amine.
| Compound Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-1-ium-2-amine |
|---|---|
| PubChem CID | 6926350 |
| Molecular Formula | C20H20N3+ |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-[(2R)-1-(1H-indol-3-yl)propan-2-yl]quinolin-1-ium-2-amine |
| SMILES | C[C@H](Cc1c[nH]c2ccccc12)Nc1ccc2ccccc2[nH+]1 |
| InChI | InChI=1S/C20H19N3/c1-14(12-16-13-21-19-9-5-3-7-17(16)19)22-20-11-10-15-6-2-4-8-18(15)23-20/h2-11,13-14,21H,12H2,1H3,(H,22,23)/p+1/t14-/m1/s1 |
| InChIKey | JROTXPVKVRQMGU-CQSZACIVSA-O |
| XLogP | 4.18 |
| TPSA | 41.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |