C36H42N8O2 — CID 71603608
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 71603608) has the molecular formula C36H42N8O2 and a molecular weight of 618.79 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 71603608 |
| Molecular Formula | C36H42N8O2 |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)N[C@H]2CC[C@@H](Oc3ccc4nnc(N5CCCCC5)n4c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C36H42N8O2/c1-24-12-14-25(15-13-24)44-33(22-31(41-44)36(2,3)4)38-34(45)37-29-17-18-30(28-11-7-6-10-27(28)29)46-26-16-19-32-39-40-35(43(32)23-26)42-20-8-5-9-21-42/h6-7,10-16,19,22-23,29-30H,5,8-9,17-18,20-21H2,1-4H3,(H2,37,38,45)/t29-,30+/m0/s1 |
| InChIKey | FNZGHWSBOGBXEO-XZWHSSHBSA-N |
| XLogP | 7.29 |
| TPSA | 101.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |