C30H28ClN3O5 — CID 71604890
ethyl 5-(4-chlorophenyl)-2-methyl-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]phenyl]furan-3-carboxylate (PubChem CID 71604890) has the molecular formula C30H28ClN3O5 and a molecular weight of 546.02 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-methyl-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]phenyl]furan-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-methyl-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]phenyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 71604890 |
| Molecular Formula | C30H28ClN3O5 |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-methyl-4-[3-[4-(4-nitrophenyl)piperazin-1-yl]phenyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(-c2ccc(Cl)cc2)c1-c1cccc(N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c1 |
| InChI | InChI=1S/C30H28ClN3O5/c1-3-38-30(35)27-20(2)39-29(21-7-9-23(31)10-8-21)28(27)22-5-4-6-26(19-22)33-17-15-32(16-18-33)24-11-13-25(14-12-24)34(36)37/h4-14,19H,3,15-18H2,1-2H3 |
| InChIKey | XRYWYZONJBPMPS-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|