C24H18O2S2 — CID 71604941
4,9-bis(phenylsulfanyl)-2,7-dihydropyrano[2,3-g]chromene (PubChem CID 71604941) has the molecular formula C24H18O2S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 4,9-bis(phenylsulfanyl)-2,7-dihydropyrano[2,3-g]chromene.
| Compound Name | 4,9-bis(phenylsulfanyl)-2,7-dihydropyrano[2,3-g]chromene |
|---|---|
| PubChem CID | 71604941 |
| Molecular Formula | C24H18O2S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 4,9-bis(phenylsulfanyl)-2,7-dihydropyrano[2,3-g]chromene |
| SMILES | C1=C(Sc2ccccc2)c2cc3c(cc2OC1)C(Sc1ccccc1)=CCO3 |
| InChI | InChI=1S/C24H18O2S2/c1-3-7-17(8-4-1)27-23-11-13-25-21-16-20-22(15-19(21)23)26-14-12-24(20)28-18-9-5-2-6-10-18/h1-12,15-16H,13-14H2 |
| InChIKey | KLGBJEQQAMCHIB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |