C13H10F3IO3 — CID 71605229
ethyl (2E)-4,4,4-trifluoro-2-[(3-iodophenyl)methylidene]-3-oxobutanoate (PubChem CID 71605229) has the molecular formula C13H10F3IO3 and a molecular weight of 398.12 g/mol. Its IUPAC name is ethyl (2E)-4,4,4-trifluoro-2-[(3-iodophenyl)methylidene]-3-oxobutanoate.
| Compound Name | ethyl (2E)-4,4,4-trifluoro-2-[(3-iodophenyl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 71605229 |
| Molecular Formula | C13H10F3IO3 |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | ethyl (2E)-4,4,4-trifluoro-2-[(3-iodophenyl)methylidene]-3-oxobutanoate |
| SMILES | CCOC(=O)/C(=C/c1cccc(I)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H10F3IO3/c1-2-20-12(19)10(11(18)13(14,15)16)7-8-4-3-5-9(17)6-8/h3-7H,2H2,1H3/b10-7+ |
| InChIKey | YKCWLGWFKZAWPD-JXMROGBWSA-N |
| XLogP | 3.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|