C17H30F2O2 — CID 71605813
1,1-diethoxy-4,4-difluorotridec-2-yne (PubChem CID 71605813) has the molecular formula C17H30F2O2 and a molecular weight of 304.42 g/mol. Its IUPAC name is 1,1-diethoxy-4,4-difluorotridec-2-yne.
| Compound Name | 1,1-diethoxy-4,4-difluorotridec-2-yne |
|---|---|
| PubChem CID | 71605813 |
| Molecular Formula | C17H30F2O2 |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1,1-diethoxy-4,4-difluorotridec-2-yne |
| SMILES | CCCCCCCCCC(F)(F)C#CC(OCC)OCC |
| InChI | InChI=1S/C17H30F2O2/c1-4-7-8-9-10-11-12-14-17(18,19)15-13-16(20-5-2)21-6-3/h16H,4-12,14H2,1-3H3 |
| InChIKey | UGJPMMWRARWHGJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|