C15H16ClFN4 — CID 71606095
5-amino-1-tert-butyl-3-[(3-chloro-2-fluorophenyl)methyl]pyrazole-4-carbonitrile (PubChem CID 71606095) has the molecular formula C15H16ClFN4 and a molecular weight of 306.77 g/mol. Its IUPAC name is 5-amino-1-tert-butyl-3-[(3-chloro-2-fluorophenyl)methyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-tert-butyl-3-[(3-chloro-2-fluorophenyl)methyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 71606095 |
| Molecular Formula | C15H16ClFN4 |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 5-amino-1-tert-butyl-3-[(3-chloro-2-fluorophenyl)methyl]pyrazole-4-carbonitrile |
| SMILES | CC(C)(C)n1nc(Cc2cccc(Cl)c2F)c(C#N)c1N |
| InChI | InChI=1S/C15H16ClFN4/c1-15(2,3)21-14(19)10(8-18)12(20-21)7-9-5-4-6-11(16)13(9)17/h4-6H,7,19H2,1-3H3 |
| InChIKey | FLVCOKFXWMISLR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |