C29H36FN3O4 — CID 71610405
8-[(2-fluorophenyl)methoxy]-4-(3-methoxypropoxy)-N-[(3R)-1-propan-2-ylpiperidin-3-yl]quinoline-2-carboxamide (PubChem CID 71610405) has the molecular formula C29H36FN3O4 and a molecular weight of 509.62 g/mol. Its IUPAC name is 8-[(2-fluorophenyl)methoxy]-4-(3-methoxypropoxy)-N-[(3R)-1-propan-2-ylpiperidin-3-yl]quinoline-2-carboxamide.
| Compound Name | 8-[(2-fluorophenyl)methoxy]-4-(3-methoxypropoxy)-N-[(3R)-1-propan-2-ylpiperidin-3-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 71610405 |
| Molecular Formula | C29H36FN3O4 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 8-[(2-fluorophenyl)methoxy]-4-(3-methoxypropoxy)-N-[(3R)-1-propan-2-ylpiperidin-3-yl]quinoline-2-carboxamide |
| SMILES | COCCCOc1cc(C(=O)N[C@@H]2CCCN(C(C)C)C2)nc2c(OCc3ccccc3F)cccc12 |
| InChI | InChI=1S/C29H36FN3O4/c1-20(2)33-14-7-10-22(18-33)31-29(34)25-17-27(36-16-8-15-35-3)23-11-6-13-26(28(23)32-25)37-19-21-9-4-5-12-24(21)30/h4-6,9,11-13,17,20,22H,7-8,10,14-16,18-19H2,1-3H3,(H,31,34)/t22-/m1/s1 |
| InChIKey | PTYRDZBGHGIGRG-JOCHJYFZSA-N |
| XLogP | 4.97 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|