C27H26BrF2NO2 — CID 71611096
6-[(4-tert-butylphenyl)methyl]-5-(2,4-difluorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide (PubChem CID 71611096) has the molecular formula C27H26BrF2NO2 and a molecular weight of 514.41 g/mol. Its IUPAC name is 6-[(4-tert-butylphenyl)methyl]-5-(2,4-difluorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide.
| Compound Name | 6-[(4-tert-butylphenyl)methyl]-5-(2,4-difluorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
|---|---|
| PubChem CID | 71611096 |
| Molecular Formula | C27H26BrF2NO2 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 6-[(4-tert-butylphenyl)methyl]-5-(2,4-difluorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolin-6-ium bromide |
| SMILES | CC(C)(C)c1ccc(C[N+]2=C(c3ccc(F)cc3F)c3cc4c(cc3CC2)OCO4)cc1.[Br-] |
| InChI | InChI=1S/C27H26F2NO2.BrH/c1-27(2,3)19-6-4-17(5-7-19)15-30-11-10-18-12-24-25(32-16-31-24)14-22(18)26(30)21-9-8-20(28)13-23(21)29;/h4-9,12-14H,10-11,15-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RIRUAPBCLZVJGL-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|