C20H32O2 — CID 71613081
8,8-dicyclohexyl-8-hydroxyoct-6-yn-2-one (PubChem CID 71613081) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 8,8-dicyclohexyl-8-hydroxyoct-6-yn-2-one.
| Compound Name | 8,8-dicyclohexyl-8-hydroxyoct-6-yn-2-one |
|---|---|
| PubChem CID | 71613081 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 8,8-dicyclohexyl-8-hydroxyoct-6-yn-2-one |
| SMILES | CC(=O)CCCC#CC(O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H32O2/c1-17(21)11-5-4-10-16-20(22,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h18-19,22H,2-9,11-15H2,1H3 |
| InChIKey | QXRKXBNJHPJCID-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|