C29H33N2O8P — CID 71615230
[4-[(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]phenyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 71615230) has the molecular formula C29H33N2O8P and a molecular weight of 568.56 g/mol. Its IUPAC name is [4-[(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]phenyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [4-[(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]phenyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 71615230 |
| Molecular Formula | C29H33N2O8P |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | [4-[(2S)-2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]phenyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C[N+](C)(C)CCOP(=O)([O-])Oc1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C29H33N2O8P/c1-31(2,3)16-17-38-40(35,36)39-21-14-12-20(13-15-21)18-27(28(32)33)30-29(34)37-19-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,26-27H,16-19H2,1-3H3,(H2-,30,32,33,34,35,36)/t27-/m0/s1 |
| InChIKey | QNUSRSZRDWEDGF-MHZLTWQESA-N |
| XLogP | 3.79 |
| TPSA | 134.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|