C29H28FNO — CID 71617604
4-[(Z)-1-[3-fluoro-4-(3-pyrrolidin-1-ylprop-1-ynyl)phenyl]-2-phenylbut-1-enyl]phenol (PubChem CID 71617604) has the molecular formula C29H28FNO and a molecular weight of 425.55 g/mol. Its IUPAC name is 4-[(Z)-1-[3-fluoro-4-(3-pyrrolidin-1-ylprop-1-ynyl)phenyl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 4-[(Z)-1-[3-fluoro-4-(3-pyrrolidin-1-ylprop-1-ynyl)phenyl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 71617604 |
| Molecular Formula | C29H28FNO |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-[(Z)-1-[3-fluoro-4-(3-pyrrolidin-1-ylprop-1-ynyl)phenyl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC/C(=C(\c1ccc(O)cc1)c1ccc(C#CCN2CCCC2)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C29H28FNO/c1-2-27(22-9-4-3-5-10-22)29(24-14-16-26(32)17-15-24)25-13-12-23(28(30)21-25)11-8-20-31-18-6-7-19-31/h3-5,9-10,12-17,21,32H,2,6-7,18-20H2,1H3/b29-27- |
| InChIKey | HVTPBLVGDPOYHX-OHYPFYFLSA-N |
| XLogP | 6.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|