About (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide
(2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide (PubChem CID 71618571) has the molecular formula C20H22ClNO3
and a molecular weight of 359.85 g/mol. Its IUPAC name is (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide.
Molecular Properties
| Compound Name | (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide |
| PubChem CID | 71618571 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide |
| SMILES | CCC/C(=C\C1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)N(CC)CC |
| InChI | InChI=1S/C20H22ClNO3/c1-4-9-13(20(25)22(5-2)6-3)12-16-17(21)19(24)15-11-8-7-10-14(15)18(16)23/h7-8,10-12H,4-6,9H2,1-3H3/b13-12+ |
| InChIKey | TWTUWNVHFKJUEL-OUKQBFOZSA-N |
| XLogP | 4.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide?
The IUPAC name of (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide (CID 71618571) is (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide.
What is the SMILES notation for (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide?
The canonical SMILES for (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide is CCC/C(=C\C1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)N(CC)CC.
What is the InChIKey of (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide?
The InChIKey is TWTUWNVHFKJUEL-OUKQBFOZSA-N. The full InChI is InChI=1S/C20H22ClNO3/c1-4-9-13(20(25)22(5-2)6-3)12-16-17(21)19(24)15-11-8-7-10-14(15)18(16)23/h7-8,10-12H,4-6,9H2,1-3H3/b13-12+.
What are the key properties of (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide?
(2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide has a molecular weight of 359.85 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide is sourced from PubChem (CID 71618571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).