C20H22ClNO3 — CID 71618571
(2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide (PubChem CID 71618571) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide.
| Compound Name | (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 71618571 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (2E)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)methylidene]-N,N-diethylpentanamide |
| SMILES | CCC/C(=C\C1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)N(CC)CC |
| InChI | InChI=1S/C20H22ClNO3/c1-4-9-13(20(25)22(5-2)6-3)12-16-17(21)19(24)15-11-8-7-10-14(15)18(16)23/h7-8,10-12H,4-6,9H2,1-3H3/b13-12+ |
| InChIKey | TWTUWNVHFKJUEL-OUKQBFOZSA-N |
| XLogP | 4.15 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|