C25H50NO7P — CID 71618628
(2R)-2-amino-3-[5-[(E)-heptadec-8-enoxy]pentoxy-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 71618628) has the molecular formula C25H50NO7P and a molecular weight of 507.65 g/mol. Its IUPAC name is (2R)-2-amino-3-[5-[(E)-heptadec-8-enoxy]pentoxy-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[5-[(E)-heptadec-8-enoxy]pentoxy-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 71618628 |
| Molecular Formula | C25H50NO7P |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.33 |
| IUPAC Name | (2R)-2-amino-3-[5-[(E)-heptadec-8-enoxy]pentoxy-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCOCCCCCOP(=O)(O)OC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C25H50NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-20-31-21-18-16-19-22-32-34(29,30)33-23-24(26)25(27)28/h9-10,24H,2-8,11-23,26H2,1H3,(H,27,28)(H,29,30)/b10-9+/t24-/m1/s1 |
| InChIKey | CDTSRCCMWKULDP-HBRDYDSTSA-N |
| XLogP | 6.37 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|