C24H21F27O6 — CID 71619040
tert-butyl 3-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propoxy]propanoate (PubChem CID 71619040) has the molecular formula C24H21F27O6 and a molecular weight of 918.37 g/mol. Its IUPAC name is tert-butyl 3-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propoxy]propanoate.
| Compound Name | tert-butyl 3-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propoxy]propanoate |
|---|---|
| PubChem CID | 71619040 |
| Molecular Formula | C24H21F27O6 |
| Molecular Weight | 918.37 g/mol |
| Exact Mass | 918.09 |
| IUPAC Name | tert-butyl 3-[3-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-2,2-bis[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxymethyl]propoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCC(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)(COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)COC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H21F27O6/c1-11(2,3)57-10(52)4-5-53-6-12(7-54-13(16(25,26)27,17(28,29)30)18(31,32)33,8-55-14(19(34,35)36,20(37,38)39)21(40,41)42)9-56-15(22(43,44)45,23(46,47)48)24(49,50)51/h4-9H2,1-3H3 |
| InChIKey | FLVIFNCWEIOWDR-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.37 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|