C14H20O7 — CID 71620249
(E,3Z)-3-[2-(methoxymethoxy)-2-oxoethylidene]dec-4-enedioic acid (PubChem CID 71620249) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is (E,3Z)-3-[2-(methoxymethoxy)-2-oxoethylidene]dec-4-enedioic acid.
| Compound Name | (E,3Z)-3-[2-(methoxymethoxy)-2-oxoethylidene]dec-4-enedioic acid |
|---|---|
| PubChem CID | 71620249 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (E,3Z)-3-[2-(methoxymethoxy)-2-oxoethylidene]dec-4-enedioic acid |
| SMILES | COCOC(=O)/C=C(\C=C\CCCCC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H20O7/c1-20-10-21-14(19)9-11(8-13(17)18)6-4-2-3-5-7-12(15)16/h4,6,9H,2-3,5,7-8,10H2,1H3,(H,15,16)(H,17,18)/b6-4+,11-9+ |
| InChIKey | KDFLSIDIXQHJAY-HBWGMBCBSA-N |
| XLogP | 1.74 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|