C23H24N2O4 — CID 71621570
(3S)-3-[4-[[2-oxo-2-(3-propan-2-ylanilino)acetyl]amino]phenyl]hex-4-ynoic acid (PubChem CID 71621570) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (3S)-3-[4-[[2-oxo-2-(3-propan-2-ylanilino)acetyl]amino]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[2-oxo-2-(3-propan-2-ylanilino)acetyl]amino]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 71621570 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (3S)-3-[4-[[2-oxo-2-(3-propan-2-ylanilino)acetyl]amino]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(NC(=O)C(=O)Nc2cccc(C(C)C)c2)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-4-6-18(14-21(26)27)16-9-11-19(12-10-16)24-22(28)23(29)25-20-8-5-7-17(13-20)15(2)3/h5,7-13,15,18H,14H2,1-3H3,(H,24,28)(H,25,29)(H,26,27)/t18-/m0/s1 |
| InChIKey | LDRNJOJYBSCSRV-SFHVURJKSA-N |
| XLogP | 3.97 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|