C16H12ClFN2O — CID 71622207
5-chloro-1-ethyl-3-(4-fluorophenyl)-1,6-naphthyridin-4-one (PubChem CID 71622207) has the molecular formula C16H12ClFN2O and a molecular weight of 302.74 g/mol. Its IUPAC name is 5-chloro-1-ethyl-3-(4-fluorophenyl)-1,6-naphthyridin-4-one.
| Compound Name | 5-chloro-1-ethyl-3-(4-fluorophenyl)-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 71622207 |
| Molecular Formula | C16H12ClFN2O |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-chloro-1-ethyl-3-(4-fluorophenyl)-1,6-naphthyridin-4-one |
| SMILES | CCn1cc(-c2ccc(F)cc2)c(=O)c2c(Cl)nccc21 |
| InChI | InChI=1S/C16H12ClFN2O/c1-2-20-9-12(10-3-5-11(18)6-4-10)15(21)14-13(20)7-8-19-16(14)17/h3-9H,2H2,1H3 |
| InChIKey | ORBBQNYUBRAZAZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|