C22H26N4O4 — CID 71622474
5,6,7-trimethoxy-4-[4-(3-methoxyphenyl)piperazin-1-yl]quinazoline (PubChem CID 71622474) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-[4-(3-methoxyphenyl)piperazin-1-yl]quinazoline.
| Compound Name | 5,6,7-trimethoxy-4-[4-(3-methoxyphenyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 71622474 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 5,6,7-trimethoxy-4-[4-(3-methoxyphenyl)piperazin-1-yl]quinazoline |
| SMILES | COc1cccc(N2CCN(c3ncnc4cc(OC)c(OC)c(OC)c34)CC2)c1 |
| InChI | InChI=1S/C22H26N4O4/c1-27-16-7-5-6-15(12-16)25-8-10-26(11-9-25)22-19-17(23-14-24-22)13-18(28-2)20(29-3)21(19)30-4/h5-7,12-14H,8-11H2,1-4H3 |
| InChIKey | SDDWLQABGANCIG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |