C22H26N4O6S — CID 71622340
5,6,7-trimethoxy-4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]quinazoline (PubChem CID 71622340) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is 5,6,7-trimethoxy-4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]quinazoline.
| Compound Name | 5,6,7-trimethoxy-4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 71622340 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 5,6,7-trimethoxy-4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]quinazoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3ncnc4cc(OC)c(OC)c(OC)c34)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O6S/c1-29-15-5-7-16(8-6-15)33(27,28)26-11-9-25(10-12-26)22-19-17(23-14-24-22)13-18(30-2)20(31-3)21(19)32-4/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | LURQMKBNQQUOCY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |