C22H29NO2 — CID 71624271
(2R,5S)-2,5-bis[2-(3-methoxyphenyl)ethyl]pyrrolidine (PubChem CID 71624271) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2R,5S)-2,5-bis[2-(3-methoxyphenyl)ethyl]pyrrolidine.
| Compound Name | (2R,5S)-2,5-bis[2-(3-methoxyphenyl)ethyl]pyrrolidine |
|---|---|
| PubChem CID | 71624271 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (2R,5S)-2,5-bis[2-(3-methoxyphenyl)ethyl]pyrrolidine |
| SMILES | COc1cccc(CC[C@@H]2CC[C@H](CCc3cccc(OC)c3)N2)c1 |
| InChI | InChI=1S/C22H29NO2/c1-24-21-7-3-5-17(15-21)9-11-19-13-14-20(23-19)12-10-18-6-4-8-22(16-18)25-2/h3-8,15-16,19-20,23H,9-14H2,1-2H3/t19-,20+ |
| InChIKey | ZLEDCHLFJIYXCU-BGYRXZFFSA-N |
| XLogP | 4.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |