C20H20FN5O — CID 71627322
5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-4-fluoro-N-phenylbenzamide (PubChem CID 71627322) has the molecular formula C20H20FN5O and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-4-fluoro-N-phenylbenzamide.
| Compound Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-4-fluoro-N-phenylbenzamide |
|---|---|
| PubChem CID | 71627322 |
| Molecular Formula | C20H20FN5O |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-cyano-2-[(1,4-dimethylpiperazin-2-ylidene)amino]-4-fluoro-N-phenylbenzamide |
| SMILES | CN1CCN(C)/C(=N\c2cc(F)c(C#N)cc2C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H20FN5O/c1-25-8-9-26(2)19(13-25)24-18-11-17(21)14(12-22)10-16(18)20(27)23-15-6-4-3-5-7-15/h3-7,10-11H,8-9,13H2,1-2H3,(H,23,27)/b24-19- |
| InChIKey | LAHSLFBEBUFIMG-CLCOLTQESA-N |
| XLogP | 2.86 |
| TPSA | 71.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|