C15H8Cl2F3N3O2S — CID 71628234
3-chloro-2-[2-(4-chlorophenyl)sulfonylpyrazol-3-yl]-5-(trifluoromethyl)pyridine (PubChem CID 71628234) has the molecular formula C15H8Cl2F3N3O2S and a molecular weight of 422.22 g/mol. Its IUPAC name is 3-chloro-2-[2-(4-chlorophenyl)sulfonylpyrazol-3-yl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[2-(4-chlorophenyl)sulfonylpyrazol-3-yl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 71628234 |
| Molecular Formula | C15H8Cl2F3N3O2S |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 420.97 |
| IUPAC Name | 3-chloro-2-[2-(4-chlorophenyl)sulfonylpyrazol-3-yl]-5-(trifluoromethyl)pyridine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)n1nccc1-c1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H8Cl2F3N3O2S/c16-10-1-3-11(4-2-10)26(24,25)23-13(5-6-22-23)14-12(17)7-9(8-21-14)15(18,19)20/h1-8H |
| InChIKey | UFZSCSMOFULEFQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |